Arachidic acid, also known as icosanoic acid, is a saturated fatty acid with a 20-carbon chain. It is a minor constituent of cupuaçu butter (7%),[2] perilla oil (0–1%),[3] peanut oil (1.1–1.7%),[4] corn oil (3%),[5] and cocoa butter (1%).[6] It also constitutes 7.08% of the fats from the fruit of the durian species Durio graveolens.[7] The salts and esters of arachidic acid are known as arachidates.
Arachidic acid |
 |
| Names |
|---|
| Preferred IUPAC name |
| Other names Eicosanoic acid n-Eicosanoic acid Arachidic acid Arachic acid C20:0 (Lipid numbers) |
| Identifiers |
|---|
CAS Number | - 506-30-9

|
3D model (JSmol) | |
| ChEBI | - CHEBI:28822

|
| ChEMBL | - ChEMBL1173381

|
| ChemSpider | - 10035

|
| ECHA InfoCard | 100.007.302  |
| KEGG | - C06425

|
| |
| UNII | - PQB8MJD4RB

|
| - DTXSID1060134

|
InChI=1S/C20H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-19H2,1H3,(H,21,22)  Key: VKOBVWXKNCXXDE-UHFFFAOYSA-N  InChI=1/C20H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-19H2,1H3,(H,21,22) Key: VKOBVWXKNCXXDE-UHFFFAOYAB
|
O=C(O)CCCCCCCCCCCCCCCCCCC
|
| Properties[1] |
|---|
Chemical formula | C20H40O2 |
| Molar mass | 312.538 g·mol−1 |
| Appearance | White crystalline solid |
| Density | 0.8240 g/cm3 |
| Melting point | 75.4 °C (167.7 °F; 348.5 K) |
| Boiling point | 328 °C (622 °F; 601 K) |
Solubility in water | Practically insoluble in water |
| Hazards |
|---|
| Flash point | 110 °C (230 °F; 383 K) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
verify (what is  ?) |
| Infobox references |
| |
Its name derives from the Latin arachis—peanut. It can be formed by the hydrogenation of arachidonic acid.
Reduction of arachidic acid yields arachidyl alcohol.
Arachidic acid is used for the production of detergents, photographic materials and lubricants.