Stearidonic acid (SDA) is an ω-3 fatty acid, sometimes called moroctic acid. It is biosynthesized from alpha-linolenic acid by the enzyme delta-6-desaturase. Natural sources of this fatty acid are the seed oils of hemp, blackcurrant, corn gromwell,[1] and Echium plantagineum, and the cyanobacterium Spirulina. SDA can also be synthesized in a lab. A GMO soybean source is approved by the European Food Safety Authority.[2]
Stearidonic acid |
 |
| Names |
|---|
Preferred IUPAC name(6Z,9Z,12Z,15Z)-Octadeca-6,9,12,15-tetraenoic acid |
| Identifiers |
|---|
CAS Number | - 20290-75-9

|
3D model (JSmol) | |
| ChEBI | - CHEBI:32389

|
| ChEMBL | - ChEMBL484430

|
| ChemSpider | - 4471933

|
| ECHA InfoCard | 100.127.224  |
| |
| UNII | - P4CEK3495O

|
| - DTXSID20920493

|
InChI=1S/C18H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10,12-13H,2,5,8,11,14-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9-,13-12-  Key: JIWBIWFOSCKQMA-LTKCOYKYSA-N  InChI=1/C18H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10,12-13H,2,5,8,11,14-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9-,13-12- Key: JIWBIWFOSCKQMA-LTKCOYKYBT
|
O=C(O)CCCC\C=C/C\C=C/C\C=C/C\C=C/CC
|
| Properties |
|---|
Chemical formula | C18H28O2 |
| Molar mass | 276.420 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
verify (what is  ?) |
| Infobox references |
| |